C24H30F3N7O — CID 112834738
1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]urea (PubChem CID 112834738) has the molecular formula C24H30F3N7O and a molecular weight of 489.55 g/mol. Its IUPAC name is 1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]urea.
| Compound Name | 1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 112834738 |
| Molecular Formula | C24H30F3N7O |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]urea |
| SMILES | CC(NC(=O)NCCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)c1nnc2ccccn12 |
| InChI | InChI=1S/C24H30F3N7O/c1-18(22-31-30-21-9-2-4-12-34(21)22)29-23(35)28-10-3-5-11-32-13-15-33(16-14-32)20-8-6-7-19(17-20)24(25,26)27/h2,4,6-9,12,17-18H,3,5,10-11,13-16H2,1H3,(H2,28,29,35) |
| InChIKey | YIPAEZFKMFAZGY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|