C27H34F3N3O — CID 70554669
1-phenyl-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]cyclohexane-1-carboxamide (PubChem CID 70554669) has the molecular formula C27H34F3N3O and a molecular weight of 473.58 g/mol. Its IUPAC name is 1-phenyl-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]cyclohexane-1-carboxamide.
| Compound Name | 1-phenyl-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 70554669 |
| Molecular Formula | C27H34F3N3O |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 1-phenyl-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C27H34F3N3O/c28-27(29,30)23-11-7-12-24(21-23)33-19-17-32(18-20-33)16-8-15-31-25(34)26(13-5-2-6-14-26)22-9-3-1-4-10-22/h1,3-4,7,9-12,21H,2,5-6,8,13-20H2,(H,31,34) |
| InChIKey | DVNVZPPBEWDGSL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|