C27H35N3O3 — CID 46483063
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]cyclopentane-1-carboxamide (PubChem CID 46483063) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 46483063 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]cyclopentane-1-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2)CC1)C1(c2ccc3c(c2)OCCO3)CCCC1 |
| InChI | InChI=1S/C27H35N3O3/c31-26(27(11-4-5-12-27)22-9-10-24-25(21-22)33-20-19-32-24)28-13-6-14-29-15-17-30(18-16-29)23-7-2-1-3-8-23/h1-3,7-10,21H,4-6,11-20H2,(H,28,31) |
| InChIKey | RGRCGMHRBAKCQY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|