C25H31F2N3O2 — CID 86901785
4-(3-fluorophenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]oxane-4-carboxamide (PubChem CID 86901785) has the molecular formula C25H31F2N3O2 and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]oxane-4-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 86901785 |
| Molecular Formula | C25H31F2N3O2 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 4-(3-fluorophenyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]oxane-4-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C25H31F2N3O2/c26-21-6-3-5-20(19-21)25(9-17-32-18-10-25)24(31)28-11-4-12-29-13-15-30(16-14-29)23-8-2-1-7-22(23)27/h1-3,5-8,19H,4,9-18H2,(H,28,31) |
| InChIKey | MFUFASJKVNHPQU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|