C20H21BrO4 — CID 54093531
ethyl 4-bromo-2,2-dimethyl-3-oxo-4-(4-phenylphenoxy)butanoate (PubChem CID 54093531) has the molecular formula C20H21BrO4 and a molecular weight of 405.29 g/mol. Its IUPAC name is ethyl 4-bromo-2,2-dimethyl-3-oxo-4-(4-phenylphenoxy)butanoate.
| Compound Name | ethyl 4-bromo-2,2-dimethyl-3-oxo-4-(4-phenylphenoxy)butanoate |
|---|---|
| PubChem CID | 54093531 |
| Molecular Formula | C20H21BrO4 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | ethyl 4-bromo-2,2-dimethyl-3-oxo-4-(4-phenylphenoxy)butanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)C(Br)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21BrO4/c1-4-24-19(23)20(2,3)17(22)18(21)25-16-12-10-15(11-13-16)14-8-6-5-7-9-14/h5-13,18H,4H2,1-3H3 |
| InChIKey | MVNFQRMJENJIPR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|