C13H15BrO4 — CID 20538631
4-bromo-2,2-dimethyl-4-(2-methylphenoxy)-3-oxobutanoic acid (PubChem CID 20538631) has the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. Its IUPAC name is 4-bromo-2,2-dimethyl-4-(2-methylphenoxy)-3-oxobutanoic acid.
| Compound Name | 4-bromo-2,2-dimethyl-4-(2-methylphenoxy)-3-oxobutanoic acid |
|---|---|
| PubChem CID | 20538631 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-bromo-2,2-dimethyl-4-(2-methylphenoxy)-3-oxobutanoic acid |
| SMILES | Cc1ccccc1OC(Br)C(=O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H15BrO4/c1-8-6-4-5-7-9(8)18-11(14)10(15)13(2,3)12(16)17/h4-7,11H,1-3H3,(H,16,17) |
| InChIKey | GQPTUKQPQRSXLT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|