C13H17BrO2 — CID 21326042
1-bromo-3,3-dimethyl-1-(2-methylphenoxy)butan-2-one (PubChem CID 21326042) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is 1-bromo-3,3-dimethyl-1-(2-methylphenoxy)butan-2-one.
| Compound Name | 1-bromo-3,3-dimethyl-1-(2-methylphenoxy)butan-2-one |
|---|---|
| PubChem CID | 21326042 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1-bromo-3,3-dimethyl-1-(2-methylphenoxy)butan-2-one |
| SMILES | Cc1ccccc1OC(Br)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H17BrO2/c1-9-7-5-6-8-10(9)16-12(14)11(15)13(2,3)4/h5-8,12H,1-4H3 |
| InChIKey | CMOSUBVOXBWMEG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|