C18H19FO2 — CID 13078447
1-fluoro-3,3-dimethyl-1-(4-phenylphenoxy)butan-2-one (PubChem CID 13078447) has the molecular formula C18H19FO2 and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-fluoro-3,3-dimethyl-1-(4-phenylphenoxy)butan-2-one.
| Compound Name | 1-fluoro-3,3-dimethyl-1-(4-phenylphenoxy)butan-2-one |
|---|---|
| PubChem CID | 13078447 |
| Molecular Formula | C18H19FO2 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-fluoro-3,3-dimethyl-1-(4-phenylphenoxy)butan-2-one |
| SMILES | CC(C)(C)C(=O)C(F)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19FO2/c1-18(2,3)16(20)17(19)21-15-11-9-14(10-12-15)13-7-5-4-6-8-13/h4-12,17H,1-3H3 |
| InChIKey | FSGKSNWFOGTXPS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |