C15H11F5O — CID 150268284
1-(1,1,1,3,3-pentafluoropropan-2-yloxy)-4-phenylbenzene (PubChem CID 150268284) has the molecular formula C15H11F5O and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-(1,1,1,3,3-pentafluoropropan-2-yloxy)-4-phenylbenzene.
| Compound Name | 1-(1,1,1,3,3-pentafluoropropan-2-yloxy)-4-phenylbenzene |
|---|---|
| PubChem CID | 150268284 |
| Molecular Formula | C15H11F5O |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-(1,1,1,3,3-pentafluoropropan-2-yloxy)-4-phenylbenzene |
| SMILES | FC(F)C(Oc1ccc(-c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H11F5O/c16-14(17)13(15(18,19)20)21-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13-14H |
| InChIKey | GCZZDAYQPFBWBI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |