C11H10F3NO2 — CID 175188997
[(3S)-1,1,1-trifluoro-3-isocyanatobutan-2-yl]oxybenzene (PubChem CID 175188997) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is [(3S)-1,1,1-trifluoro-3-isocyanatobutan-2-yl]oxybenzene.
| Compound Name | [(3S)-1,1,1-trifluoro-3-isocyanatobutan-2-yl]oxybenzene |
|---|---|
| PubChem CID | 175188997 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | [(3S)-1,1,1-trifluoro-3-isocyanatobutan-2-yl]oxybenzene |
| SMILES | C[C@H](N=C=O)C(Oc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO2/c1-8(15-7-16)10(11(12,13)14)17-9-5-3-2-4-6-9/h2-6,8,10H,1H3/t8-,10?/m0/s1 |
| InChIKey | MOVKOKFUKUWWGC-PEHGTWAWSA-N |
| XLogP | 2.72 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|