About 1,1'-biphenyl;chloro(diisocyanato)methane
1,1'-biphenyl;chloro(diisocyanato)methane (PubChem CID 174916077) has the molecular formula C15H11ClN2O2
and a molecular weight of 286.72 g/mol. Its IUPAC name is 1,1'-biphenyl;chloro(diisocyanato)methane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;chloro(diisocyanato)methane |
| PubChem CID | 174916077 |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1,1'-biphenyl;chloro(diisocyanato)methane |
| SMILES | O=C=NC(Cl)N=C=O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3HClN2O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;4-3(5-1-7)6-2-8/h1-10H;3H |
| InChIKey | GYHSPLNRPQTYPG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;chloro(diisocyanato)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;chloro(diisocyanato)methane?
The IUPAC name of 1,1'-biphenyl;chloro(diisocyanato)methane (CID 174916077) is 1,1'-biphenyl;chloro(diisocyanato)methane.
What is the SMILES notation for 1,1'-biphenyl;chloro(diisocyanato)methane?
The canonical SMILES for 1,1'-biphenyl;chloro(diisocyanato)methane is O=C=NC(Cl)N=C=O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;chloro(diisocyanato)methane?
The InChIKey is GYHSPLNRPQTYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C3HClN2O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;4-3(5-1-7)6-2-8/h1-10H;3H.
What are the key properties of 1,1'-biphenyl;chloro(diisocyanato)methane?
1,1'-biphenyl;chloro(diisocyanato)methane has a molecular weight of 286.72 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;chloro(diisocyanato)methane is sourced from PubChem (CID 174916077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).