C20H27BrO4 — CID 54571467
ethyl 4-bromo-4-(2-cyclohexylphenoxy)-2,2-dimethyl-3-oxobutanoate (PubChem CID 54571467) has the molecular formula C20H27BrO4 and a molecular weight of 411.34 g/mol. Its IUPAC name is ethyl 4-bromo-4-(2-cyclohexylphenoxy)-2,2-dimethyl-3-oxobutanoate.
| Compound Name | ethyl 4-bromo-4-(2-cyclohexylphenoxy)-2,2-dimethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 54571467 |
| Molecular Formula | C20H27BrO4 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | ethyl 4-bromo-4-(2-cyclohexylphenoxy)-2,2-dimethyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)C(Br)Oc1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C20H27BrO4/c1-4-24-19(23)20(2,3)17(22)18(21)25-16-13-9-8-12-15(16)14-10-6-5-7-11-14/h8-9,12-14,18H,4-7,10-11H2,1-3H3 |
| InChIKey | ZXOMSEMJAFVOPI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|