About (2-cyclobutylphenyl) acetate
(2-cyclobutylphenyl) acetate (PubChem CID 176943294) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is (2-cyclobutylphenyl) acetate.
Molecular Properties
| Compound Name | (2-cyclobutylphenyl) acetate |
| PubChem CID | 176943294 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2-cyclobutylphenyl) acetate |
| SMILES | CC(=O)Oc1ccccc1C1CCC1 |
| InChI | InChI=1S/C12H14O2/c1-9(13)14-12-8-3-2-7-11(12)10-5-4-6-10/h2-3,7-8,10H,4-6H2,1H3 |
| InChIKey | KNBSXSFJDDPGAJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclobutylphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclobutylphenyl) acetate?
The IUPAC name of (2-cyclobutylphenyl) acetate (CID 176943294) is (2-cyclobutylphenyl) acetate.
What is the SMILES notation for (2-cyclobutylphenyl) acetate?
The canonical SMILES for (2-cyclobutylphenyl) acetate is CC(=O)Oc1ccccc1C1CCC1.
What is the InChIKey of (2-cyclobutylphenyl) acetate?
The InChIKey is KNBSXSFJDDPGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-9(13)14-12-8-3-2-7-11(12)10-5-4-6-10/h2-3,7-8,10H,4-6H2,1H3.
What are the key properties of (2-cyclobutylphenyl) acetate?
(2-cyclobutylphenyl) acetate has a molecular weight of 190.24 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclobutylphenyl) acetate is sourced from PubChem (CID 176943294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).