About (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate
(2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 153354225) has the molecular formula C19H18O2
and a molecular weight of 278.35 g/mol. Its IUPAC name is (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate |
| PubChem CID | 153354225 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)Oc2ccccc2C2CC2)cc1 |
| InChI | InChI=1S/C19H18O2/c1-14-6-8-15(9-7-14)10-13-19(20)21-18-5-3-2-4-17(18)16-11-12-16/h2-10,13,16H,11-12H2,1H3/b13-10+ |
| InChIKey | LIHWFWLNPSVDSK-JLHYYAGUSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate?
The IUPAC name of (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate (CID 153354225) is (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate.
What is the SMILES notation for (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate?
The canonical SMILES for (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate is Cc1ccc(/C=C/C(=O)Oc2ccccc2C2CC2)cc1.
What is the InChIKey of (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate?
The InChIKey is LIHWFWLNPSVDSK-JLHYYAGUSA-N. The full InChI is InChI=1S/C19H18O2/c1-14-6-8-15(9-7-14)10-13-19(20)21-18-5-3-2-4-17(18)16-11-12-16/h2-10,13,16H,11-12H2,1H3/b13-10+.
What are the key properties of (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate?
(2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate has a molecular weight of 278.35 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopropylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate is sourced from PubChem (CID 153354225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).