About (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate
(2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 917922) has the molecular formula C19H20O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate |
| PubChem CID | 917922 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)Oc2ccccc2C(C)C)cc1 |
| InChI | InChI=1S/C19H20O2/c1-14(2)17-6-4-5-7-18(17)21-19(20)13-12-16-10-8-15(3)9-11-16/h4-14H,1-3H3/b13-12+ |
| InChIKey | OKGGFOLGUHZOJA-OUKQBFOZSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate?
The IUPAC name of (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate (CID 917922) is (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate.
What is the SMILES notation for (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate?
The canonical SMILES for (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate is Cc1ccc(/C=C/C(=O)Oc2ccccc2C(C)C)cc1.
What is the InChIKey of (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate?
The InChIKey is OKGGFOLGUHZOJA-OUKQBFOZSA-N. The full InChI is InChI=1S/C19H20O2/c1-14(2)17-6-4-5-7-18(17)21-19(20)13-12-16-10-8-15(3)9-11-16/h4-14H,1-3H3/b13-12+.
What are the key properties of (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate?
(2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate has a molecular weight of 280.37 g/mol, XLogP of 4.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propan-2-ylphenyl) (E)-3-(4-methylphenyl)prop-2-enoate is sourced from PubChem (CID 917922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).