C14H14F2O4 — CID 65403837
ethyl 3-(3,4-dihydro-2H-chromen-3-yl)-2,2-difluoro-3-oxopropanoate (PubChem CID 65403837) has the molecular formula C14H14F2O4 and a molecular weight of 284.26 g/mol. Its IUPAC name is ethyl 3-(3,4-dihydro-2H-chromen-3-yl)-2,2-difluoro-3-oxopropanoate.
| Compound Name | ethyl 3-(3,4-dihydro-2H-chromen-3-yl)-2,2-difluoro-3-oxopropanoate |
|---|---|
| PubChem CID | 65403837 |
| Molecular Formula | C14H14F2O4 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | ethyl 3-(3,4-dihydro-2H-chromen-3-yl)-2,2-difluoro-3-oxopropanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C14H14F2O4/c1-2-19-13(18)14(15,16)12(17)10-7-9-5-3-4-6-11(9)20-8-10/h3-6,10H,2,7-8H2,1H3 |
| InChIKey | HZKXHPRZQHSFKB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|