C19H18O5 — CID 9455774
(4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 9455774) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 9455774 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(OC(=O)[C@H]2COc3ccccc3C2)cc1 |
| InChI | InChI=1S/C19H18O5/c1-2-22-18(20)13-7-9-16(10-8-13)24-19(21)15-11-14-5-3-4-6-17(14)23-12-15/h3-10,15H,2,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | ULWKECDXXDMVHZ-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|