About (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate
(4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 9455774) has the molecular formula C19H18O5
and a molecular weight of 326.35 g/mol. Its IUPAC name is (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate |
| PubChem CID | 9455774 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(OC(=O)[C@H]2COc3ccccc3C2)cc1 |
| InChI | InChI=1S/C19H18O5/c1-2-22-18(20)13-7-9-16(10-8-13)24-19(21)15-11-14-5-3-4-6-17(14)23-12-15/h3-10,15H,2,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | ULWKECDXXDMVHZ-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate?
The IUPAC name of (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate (CID 9455774) is (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate.
What is the SMILES notation for (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate?
The canonical SMILES for (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate is CCOC(=O)c1ccc(OC(=O)[C@H]2COc3ccccc3C2)cc1.
What is the InChIKey of (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate?
The InChIKey is ULWKECDXXDMVHZ-OAHLLOKOSA-N. The full InChI is InChI=1S/C19H18O5/c1-2-22-18(20)13-7-9-16(10-8-13)24-19(21)15-11-14-5-3-4-6-17(14)23-12-15/h3-10,15H,2,11-12H2,1H3/t15-/m1/s1.
What are the key properties of (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate?
(4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate has a molecular weight of 326.35 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxycarbonylphenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate is sourced from PubChem (CID 9455774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).