C23H18O4 — CID 9244573
(4-benzoylphenyl) (3S)-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 9244573) has the molecular formula C23H18O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is (4-benzoylphenyl) (3S)-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | (4-benzoylphenyl) (3S)-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 9244573 |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (4-benzoylphenyl) (3S)-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | O=C(c1ccccc1)c1ccc(OC(=O)[C@@H]2COc3ccccc3C2)cc1 |
| InChI | InChI=1S/C23H18O4/c24-22(16-6-2-1-3-7-16)17-10-12-20(13-11-17)27-23(25)19-14-18-8-4-5-9-21(18)26-15-19/h1-13,19H,14-15H2/t19-/m0/s1 |
| InChIKey | OKPGIAQJGKBYIT-IBGZPJMESA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|