C16H12Cl2O3 — CID 9245021
(2,3-dichlorophenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 9245021) has the molecular formula C16H12Cl2O3 and a molecular weight of 323.18 g/mol. Its IUPAC name is (2,3-dichlorophenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | (2,3-dichlorophenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 9245021 |
| Molecular Formula | C16H12Cl2O3 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (2,3-dichlorophenyl) (3R)-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | O=C(Oc1cccc(Cl)c1Cl)[C@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C16H12Cl2O3/c17-12-5-3-7-14(15(12)18)21-16(19)11-8-10-4-1-2-6-13(10)20-9-11/h1-7,11H,8-9H2/t11-/m1/s1 |
| InChIKey | RCFMPOKEOULWQA-LLVKDONJSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|