C6H13F2N3O — CID 103211890
N-amino-3-(2,2-difluoroethoxy)-N'-methylpropanimidamide (PubChem CID 103211890) has the molecular formula C6H13F2N3O and a molecular weight of 181.19 g/mol. Its IUPAC name is N-amino-3-(2,2-difluoroethoxy)-N'-methylpropanimidamide.
| Compound Name | N-amino-3-(2,2-difluoroethoxy)-N'-methylpropanimidamide |
|---|---|
| PubChem CID | 103211890 |
| Molecular Formula | C6H13F2N3O |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N-amino-3-(2,2-difluoroethoxy)-N'-methylpropanimidamide |
| SMILES | C/N=C(\CCOCC(F)F)NN |
| InChI | InChI=1S/C6H13F2N3O/c1-10-6(11-9)2-3-12-4-5(7)8/h5H,2-4,9H2,1H3,(H,10,11) |
| InChIKey | NTPGBHUPCITAST-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|