C26H52O7 — CID 171600286
9-ethyl-1-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4,10-dimethylundecan-3-one (PubChem CID 171600286) has the molecular formula C26H52O7 and a molecular weight of 476.70 g/mol. Its IUPAC name is 9-ethyl-1-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4,10-dimethylundecan-3-one.
| Compound Name | 9-ethyl-1-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4,10-dimethylundecan-3-one |
|---|---|
| PubChem CID | 171600286 |
| Molecular Formula | C26H52O7 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | 9-ethyl-1-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4,10-dimethylundecan-3-one |
| SMILES | CCC(CCCCC(C)C(=O)CCOCCOCCOCCOCCOCCOC)C(C)C |
| InChI | InChI=1S/C26H52O7/c1-6-25(23(2)3)10-8-7-9-24(4)26(27)11-12-29-15-16-31-19-20-33-22-21-32-18-17-30-14-13-28-5/h23-25H,6-22H2,1-5H3 |
| InChIKey | YRPOZVHYNGZFQY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|