C10H18O5 — CID 102928780
methyl 5-(2-methoxyethoxy)-2-methyl-3-oxopentanoate (PubChem CID 102928780) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl 5-(2-methoxyethoxy)-2-methyl-3-oxopentanoate.
| Compound Name | methyl 5-(2-methoxyethoxy)-2-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 102928780 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | methyl 5-(2-methoxyethoxy)-2-methyl-3-oxopentanoate |
| SMILES | COCCOCCC(=O)C(C)C(=O)OC |
| InChI | InChI=1S/C10H18O5/c1-8(10(12)14-3)9(11)4-5-15-7-6-13-2/h8H,4-7H2,1-3H3 |
| InChIKey | FDJGOANGCMZJLA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|