C8H13F3N2O4 — CID 107362626
2-hydroxy-3-[3-(2,2,2-trifluoroethoxy)propanoylamino]propanamide (PubChem CID 107362626) has the molecular formula C8H13F3N2O4 and a molecular weight of 258.20 g/mol. Its IUPAC name is 2-hydroxy-3-[3-(2,2,2-trifluoroethoxy)propanoylamino]propanamide.
| Compound Name | 2-hydroxy-3-[3-(2,2,2-trifluoroethoxy)propanoylamino]propanamide |
|---|---|
| PubChem CID | 107362626 |
| Molecular Formula | C8H13F3N2O4 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-hydroxy-3-[3-(2,2,2-trifluoroethoxy)propanoylamino]propanamide |
| SMILES | NC(=O)C(O)CNC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O4/c9-8(10,11)4-17-2-1-6(15)13-3-5(14)7(12)16/h5,14H,1-4H2,(H2,12,16)(H,13,15) |
| InChIKey | CLMKFKDVORBQMF-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|