C7H14N4O4S2 — CID 114175469
N'-(2-amino-2-sulfanylideneethyl)-N-[2-(methylsulfamoyl)ethyl]oxamide (PubChem CID 114175469) has the molecular formula C7H14N4O4S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is N'-(2-amino-2-sulfanylideneethyl)-N-[2-(methylsulfamoyl)ethyl]oxamide.
| Compound Name | N'-(2-amino-2-sulfanylideneethyl)-N-[2-(methylsulfamoyl)ethyl]oxamide |
|---|---|
| PubChem CID | 114175469 |
| Molecular Formula | C7H14N4O4S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N'-(2-amino-2-sulfanylideneethyl)-N-[2-(methylsulfamoyl)ethyl]oxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)C(=O)NCC(N)=S |
| InChI | InChI=1S/C7H14N4O4S2/c1-9-17(14,15)3-2-10-6(12)7(13)11-4-5(8)16/h9H,2-4H2,1H3,(H2,8,16)(H,10,12)(H,11,13) |
| InChIKey | GHPIDLIMAGSJQW-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|