C10H24N2O — CID 174959939
N,N-diethylethanamine;N-ethylacetamide (PubChem CID 174959939) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is N,N-diethylethanamine;N-ethylacetamide.
| Compound Name | N,N-diethylethanamine;N-ethylacetamide |
|---|---|
| PubChem CID | 174959939 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | N,N-diethylethanamine;N-ethylacetamide |
| SMILES | CCN(CC)CC.CCNC(C)=O |
| InChI | InChI=1S/C6H15N.C4H9NO/c1-4-7(5-2)6-3;1-3-5-4(2)6/h4-6H2,1-3H3;3H2,1-2H3,(H,5,6) |
| InChIKey | HDZMWEGDTHOPKJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |