C12H31NO4S — CID 144515848
butane-2-sulfonic acid;ethane;N-ethylacetamide (PubChem CID 144515848) has the molecular formula C12H31NO4S and a molecular weight of 285.45 g/mol. Its IUPAC name is butane-2-sulfonic acid;ethane;N-ethylacetamide.
| Compound Name | butane-2-sulfonic acid;ethane;N-ethylacetamide |
|---|---|
| PubChem CID | 144515848 |
| Molecular Formula | C12H31NO4S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | butane-2-sulfonic acid;ethane;N-ethylacetamide |
| SMILES | CC.CC.CCC(C)S(=O)(=O)O.CCNC(C)=O |
| InChI | InChI=1S/C4H9NO.C4H10O3S.2C2H6/c1-3-5-4(2)6;1-3-4(2)8(5,6)7;2*1-2/h3H2,1-2H3,(H,5,6);4H,3H2,1-2H3,(H,5,6,7);2*1-2H3 |
| InChIKey | ILUQVXWHDUWMBU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|