About ethane;methyl 2-hydrazinylacetate
ethane;methyl 2-hydrazinylacetate (PubChem CID 170593077) has the molecular formula C5H14N2O2
and a molecular weight of 134.18 g/mol. Its IUPAC name is ethane;methyl 2-hydrazinylacetate.
Molecular Properties
| Compound Name | ethane;methyl 2-hydrazinylacetate |
| PubChem CID | 170593077 |
| Molecular Formula | C5H14N2O2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | ethane;methyl 2-hydrazinylacetate |
| SMILES | CC.COC(=O)CNN |
| InChI | InChI=1S/C3H8N2O2.C2H6/c1-7-3(6)2-5-4;1-2/h5H,2,4H2,1H3;1-2H3 |
| InChIKey | JNQOFENMWWBUEA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 2-hydrazinylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 2-hydrazinylacetate?
The IUPAC name of ethane;methyl 2-hydrazinylacetate (CID 170593077) is ethane;methyl 2-hydrazinylacetate.
What is the SMILES notation for ethane;methyl 2-hydrazinylacetate?
The canonical SMILES for ethane;methyl 2-hydrazinylacetate is CC.COC(=O)CNN.
What is the InChIKey of ethane;methyl 2-hydrazinylacetate?
The InChIKey is JNQOFENMWWBUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O2.C2H6/c1-7-3(6)2-5-4;1-2/h5H,2,4H2,1H3;1-2H3.
What are the key properties of ethane;methyl 2-hydrazinylacetate?
ethane;methyl 2-hydrazinylacetate has a molecular weight of 134.18 g/mol, XLogP of -0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 2-hydrazinylacetate is sourced from PubChem (CID 170593077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).