C16H26N6 — CID 24858984
1-cyano-3-cyclooctyl-2-(3-imidazol-1-ylpropyl)guanidine (PubChem CID 24858984) has the molecular formula C16H26N6 and a molecular weight of 302.43 g/mol. Its IUPAC name is 1-cyano-3-cyclooctyl-2-(3-imidazol-1-ylpropyl)guanidine.
| Compound Name | 1-cyano-3-cyclooctyl-2-(3-imidazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 24858984 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-cyano-3-cyclooctyl-2-(3-imidazol-1-ylpropyl)guanidine |
| SMILES | N#CN/C(=N\CCCn1ccnc1)NC1CCCCCCC1 |
| InChI | InChI=1S/C16H26N6/c17-13-20-16(19-9-6-11-22-12-10-18-14-22)21-15-7-4-2-1-3-5-8-15/h10,12,14-15H,1-9,11H2,(H2,19,20,21) |
| InChIKey | GDUGVJGJNGLVON-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|