C27H26N6 — CID 24994827
1-cyano-2-(3-imidazol-1-ylpropyl)-3-tritylguanidine (PubChem CID 24994827) has the molecular formula C27H26N6 and a molecular weight of 434.55 g/mol. Its IUPAC name is 1-cyano-2-(3-imidazol-1-ylpropyl)-3-tritylguanidine.
| Compound Name | 1-cyano-2-(3-imidazol-1-ylpropyl)-3-tritylguanidine |
|---|---|
| PubChem CID | 24994827 |
| Molecular Formula | C27H26N6 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 1-cyano-2-(3-imidazol-1-ylpropyl)-3-tritylguanidine |
| SMILES | N#CN/C(=N\CCCn1ccnc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N6/c28-21-31-26(30-17-10-19-33-20-18-29-22-33)32-27(23-11-4-1-5-12-23,24-13-6-2-7-14-24)25-15-8-3-9-16-25/h1-9,11-16,18,20,22H,10,17,19H2,(H2,30,31,32) |
| InChIKey | RAEIPCIICXUTGH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|