C18H28N4OS — CID 110963047
4-acetyl-N-ethyl-N'-(3-phenylsulfanylpropyl)piperazine-1-carboximidamide (PubChem CID 110963047) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-(3-phenylsulfanylpropyl)piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-(3-phenylsulfanylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963047 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-(3-phenylsulfanylpropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCSc1ccccc1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H28N4OS/c1-3-19-18(22-13-11-21(12-14-22)16(2)23)20-10-7-15-24-17-8-5-4-6-9-17/h4-6,8-9H,3,7,10-15H2,1-2H3,(H,19,20) |
| InChIKey | HMBCXBFWCLTUPN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|