C18H28N4O2 — CID 110963439
4-acetyl-N-ethyl-N'-[2-(2-methoxyphenyl)ethyl]piperazine-1-carboximidamide (PubChem CID 110963439) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[2-(2-methoxyphenyl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-[2-(2-methoxyphenyl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963439 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[2-(2-methoxyphenyl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccccc1OC)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H28N4O2/c1-4-19-18(22-13-11-21(12-14-22)15(2)23)20-10-9-16-7-5-6-8-17(16)24-3/h5-8H,4,9-14H2,1-3H3,(H,19,20) |
| InChIKey | OSWIHTMBCYBYMR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|