C24H32N4O2 — CID 110962871
4-acetyl-N-ethyl-N'-[2-(4-phenylmethoxyphenyl)ethyl]piperazine-1-carboximidamide (PubChem CID 110962871) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[2-(4-phenylmethoxyphenyl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-[2-(4-phenylmethoxyphenyl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110962871 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[2-(4-phenylmethoxyphenyl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccc(OCc2ccccc2)cc1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-3-25-24(28-17-15-27(16-18-28)20(2)29)26-14-13-21-9-11-23(12-10-21)30-19-22-7-5-4-6-8-22/h4-12H,3,13-19H2,1-2H3,(H,25,26) |
| InChIKey | ZMUAPRJLCNELCU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|