C21H34N4O2 — CID 110963723
4-acetyl-N-ethyl-N'-[4-(2-phenylethoxy)butyl]piperazine-1-carboximidamide (PubChem CID 110963723) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[4-(2-phenylethoxy)butyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-[4-(2-phenylethoxy)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963723 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[4-(2-phenylethoxy)butyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCOCCc1ccccc1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C21H34N4O2/c1-3-22-21(25-15-13-24(14-16-25)19(2)26)23-12-7-8-17-27-18-11-20-9-5-4-6-10-20/h4-6,9-10H,3,7-8,11-18H2,1-2H3,(H,22,23) |
| InChIKey | DCLGOSGTMILEDU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|