C23H37IN4O3 — CID 111302340
N-ethyl-4-(oxolane-2-carbonyl)-N'-[3-(2-phenylethoxy)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111302340) has the molecular formula C23H37IN4O3 and a molecular weight of 544.48 g/mol. Its IUPAC name is N-ethyl-4-(oxolane-2-carbonyl)-N'-[3-(2-phenylethoxy)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[3-(2-phenylethoxy)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111302340 |
| Molecular Formula | C23H37IN4O3 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[3-(2-phenylethoxy)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCCc1ccccc1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C23H36N4O3.HI/c1-2-24-23(25-12-7-17-29-19-11-20-8-4-3-5-9-20)27-15-13-26(14-16-27)22(28)21-10-6-18-30-21;/h3-5,8-9,21H,2,6-7,10-19H2,1H3,(H,24,25);1H |
| InChIKey | XXCPBEPGABHPFN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|