C19H30IN5O2 — CID 111302930
N-ethyl-4-(oxolane-2-carbonyl)-N'-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111302930) has the molecular formula C19H30IN5O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is N-ethyl-4-(oxolane-2-carbonyl)-N'-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111302930 |
| Molecular Formula | C19H30IN5O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccnc1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C19H29N5O2.HI/c1-2-21-19(22-9-7-16-5-3-8-20-15-16)24-12-10-23(11-13-24)18(25)17-6-4-14-26-17;/h3,5,8,15,17H,2,4,6-7,9-14H2,1H3,(H,21,22);1H |
| InChIKey | LVILJVDTQYAELZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|