C21H36IN3O — CID 111211666
N-ethyl-4-methyl-N'-[4-(2-phenylethoxy)butyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111211666) has the molecular formula C21H36IN3O and a molecular weight of 473.44 g/mol. Its IUPAC name is N-ethyl-4-methyl-N'-[4-(2-phenylethoxy)butyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-methyl-N'-[4-(2-phenylethoxy)butyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111211666 |
| Molecular Formula | C21H36IN3O |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-ethyl-4-methyl-N'-[4-(2-phenylethoxy)butyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCOCCc1ccccc1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C21H35N3O.HI/c1-3-22-21(24-15-11-19(2)12-16-24)23-14-7-8-17-25-18-13-20-9-5-4-6-10-20;/h4-6,9-10,19H,3,7-8,11-18H2,1-2H3,(H,22,23);1H |
| InChIKey | UTGIRXMXADAIJK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|