C21H35IN4O5 — CID 111164552
ethyl 4-[N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164552) has the molecular formula C21H35IN4O5 and a molecular weight of 550.44 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164552 |
| Molecular Formula | C21H35IN4O5 |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(OC)c(OC)c1OC)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H34N4O5.HI/c1-6-22-20(24-12-14-25(15-13-24)21(26)30-7-2)23-11-10-16-8-9-17(27-3)19(29-5)18(16)28-4;/h8-9H,6-7,10-15H2,1-5H3,(H,22,23);1H |
| InChIKey | FTQCUDNFPVBMOV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|