C22H30IN3O3 — CID 110983431
N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 110983431) has the molecular formula C22H30IN3O3 and a molecular weight of 511.40 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110983431 |
| Molecular Formula | C22H30IN3O3 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(OC)c(OC)c1OC)N1CCc2ccccc21.I |
| InChI | InChI=1S/C22H29N3O3.HI/c1-5-23-22(25-15-13-16-8-6-7-9-18(16)25)24-14-12-17-10-11-19(26-2)21(28-4)20(17)27-3;/h6-11H,5,12-15H2,1-4H3,(H,23,24);1H |
| InChIKey | UPRLBCDTOUZPCC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|