C23H37ClN6O — CID 111264363
1-[4-[[C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]butyl]piperidine-4-carboxamide (PubChem CID 111264363) has the molecular formula C23H37ClN6O and a molecular weight of 449.04 g/mol. Its IUPAC name is 1-[4-[[C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111264363 |
| Molecular Formula | C23H37ClN6O |
| Molecular Weight | 449.04 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 1-[4-[[C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]butyl]piperidine-4-carboxamide |
| SMILES | C/N=C(\NCCCCN1CCC(C(N)=O)CC1)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C23H37ClN6O/c1-18-5-6-20(24)17-21(18)29-13-15-30(16-14-29)23(26-2)27-9-3-4-10-28-11-7-19(8-12-28)22(25)31/h5-6,17,19H,3-4,7-16H2,1-2H3,(H2,25,31)(H,26,27) |
| InChIKey | LGOCPFJCYSCXLD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.04 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|