C15H24ClIN4S — CID 111177513
4-(2-chlorophenyl)-N'-methyl-N-(2-methylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111177513) has the molecular formula C15H24ClIN4S and a molecular weight of 454.81 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N'-methyl-N-(2-methylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2-chlorophenyl)-N'-methyl-N-(2-methylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111177513 |
| Molecular Formula | C15H24ClIN4S |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 4-(2-chlorophenyl)-N'-methyl-N-(2-methylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCSC)N1CCN(c2ccccc2Cl)CC1.I |
| InChI | InChI=1S/C15H23ClN4S.HI/c1-17-15(18-7-12-21-2)20-10-8-19(9-11-20)14-6-4-3-5-13(14)16;/h3-6H,7-12H2,1-2H3,(H,17,18);1H |
| InChIKey | BCPQIJRWDWWDTN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|