C17H25FN4S — CID 111148893
4-(2-fluorophenyl)-N'-methyl-N-(2-prop-2-enylsulfanylethyl)piperazine-1-carboximidamide (PubChem CID 111148893) has the molecular formula C17H25FN4S and a molecular weight of 336.48 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N'-methyl-N-(2-prop-2-enylsulfanylethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(2-fluorophenyl)-N'-methyl-N-(2-prop-2-enylsulfanylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148893 |
| Molecular Formula | C17H25FN4S |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-(2-fluorophenyl)-N'-methyl-N-(2-prop-2-enylsulfanylethyl)piperazine-1-carboximidamide |
| SMILES | C=CCSCCN/C(=N\C)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H25FN4S/c1-3-13-23-14-8-20-17(19-2)22-11-9-21(10-12-22)16-7-5-4-6-15(16)18/h3-7H,1,8-14H2,2H3,(H,19,20) |
| InChIKey | WVXOWPFMNPZJPU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|