C19H27FN6 — CID 111148895
4-(2-fluorophenyl)-N'-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111148895) has the molecular formula C19H27FN6 and a molecular weight of 358.47 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N'-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-fluorophenyl)-N'-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148895 |
| Molecular Formula | C19H27FN6 |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 4-(2-fluorophenyl)-N'-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCn1cc(C)cn1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H27FN6/c1-16-14-23-26(15-16)9-5-8-22-19(21-2)25-12-10-24(11-13-25)18-7-4-3-6-17(18)20/h3-4,6-7,14-15H,5,8-13H2,1-2H3,(H,21,22) |
| InChIKey | LEBUICWLMRQRNS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|