C21H32FN5O — CID 111148441
4-(2-fluorophenyl)-N'-methyl-N-[3-(2-oxopyrrolidin-1-yl)pentyl]piperazine-1-carboximidamide (PubChem CID 111148441) has the molecular formula C21H32FN5O and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N'-methyl-N-[3-(2-oxopyrrolidin-1-yl)pentyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-fluorophenyl)-N'-methyl-N-[3-(2-oxopyrrolidin-1-yl)pentyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148441 |
| Molecular Formula | C21H32FN5O |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 4-(2-fluorophenyl)-N'-methyl-N-[3-(2-oxopyrrolidin-1-yl)pentyl]piperazine-1-carboximidamide |
| SMILES | CCC(CCN/C(=N\C)N1CCN(c2ccccc2F)CC1)N1CCCC1=O |
| InChI | InChI=1S/C21H32FN5O/c1-3-17(27-12-6-9-20(27)28)10-11-24-21(23-2)26-15-13-25(14-16-26)19-8-5-4-7-18(19)22/h4-5,7-8,17H,3,6,9-16H2,1-2H3,(H,23,24) |
| InChIKey | IUUKHLZPVPCLKT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|