C16H23FN4 — CID 111148397
4-(2-fluorophenyl)-N'-methyl-N-(2-methylcyclopropyl)piperazine-1-carboximidamide (PubChem CID 111148397) has the molecular formula C16H23FN4 and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N'-methyl-N-(2-methylcyclopropyl)piperazine-1-carboximidamide.
| Compound Name | 4-(2-fluorophenyl)-N'-methyl-N-(2-methylcyclopropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148397 |
| Molecular Formula | C16H23FN4 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 4-(2-fluorophenyl)-N'-methyl-N-(2-methylcyclopropyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NC1CC1C)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C16H23FN4/c1-12-11-14(12)19-16(18-2)21-9-7-20(8-10-21)15-6-4-3-5-13(15)17/h3-6,12,14H,7-11H2,1-2H3,(H,18,19) |
| InChIKey | OBSVIQONCZILKX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|