C16H23FN4 — CID 119153263
N-cyclobutyl-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 119153263) has the molecular formula C16H23FN4 and a molecular weight of 290.39 g/mol. Its IUPAC name is N-cyclobutyl-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-cyclobutyl-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119153263 |
| Molecular Formula | C16H23FN4 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | N-cyclobutyl-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NC1CCC1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C16H23FN4/c1-18-16(19-13-5-4-6-13)21-11-9-20(10-12-21)15-8-3-2-7-14(15)17/h2-3,7-8,13H,4-6,9-12H2,1H3,(H,18,19) |
| InChIKey | MCLSPGJOXYABES-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|