C18H25ClF3N5 — CID 111177406
4-(2-chlorophenyl)-N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperazine-1-carboximidamide (PubChem CID 111177406) has the molecular formula C18H25ClF3N5 and a molecular weight of 403.88 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111177406 |
| Molecular Formula | C18H25ClF3N5 |
| Molecular Weight | 403.88 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 4-(2-chlorophenyl)-N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperazine-1-carboximidamide |
| SMILES | C/N=C(/NC1CCN(CC(F)(F)F)C1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H25ClF3N5/c1-23-17(24-14-6-7-25(12-14)13-18(20,21)22)27-10-8-26(9-11-27)16-5-3-2-4-15(16)19/h2-5,14H,6-13H2,1H3,(H,23,24) |
| InChIKey | WYENKENDGHEKDK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.88 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|