C18H25F3N4 — CID 110946682
N'-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 110946682) has the molecular formula C18H25F3N4 and a molecular weight of 354.42 g/mol. Its IUPAC name is N'-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 110946682 |
| Molecular Formula | C18H25F3N4 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | N'-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | CC/N=C(/NC1CCN(CC(F)(F)F)C1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H25F3N4/c1-2-22-17(23-16-8-9-24(12-16)13-18(19,20)21)25-10-7-14-5-3-4-6-15(14)11-25/h3-6,16H,2,7-13H2,1H3,(H,22,23) |
| InChIKey | GBPOQXGCDZLXLA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|