C18H24F3N5O — CID 111915489
1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915489) has the molecular formula C18H24F3N5O and a molecular weight of 383.42 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915489 |
| Molecular Formula | C18H24F3N5O |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCC(=O)N1CCc2ccccc21)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C18H24F3N5O/c1-22-17(24-14-7-8-25(11-14)12-18(19,20)21)23-10-16(27)26-9-6-13-4-2-3-5-15(13)26/h2-5,14H,6-12H2,1H3,(H2,22,23,24) |
| InChIKey | JEVOYPIVHIFLSW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|