C30H44F2N4 — CID 170056186
(3E)-3-[(Z)-but-2-en-2-yl]-5-N-[1-(2,2-difluoropropyl)pyrrolidin-3-yl]-2-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]hexa-1,3,5-triene-2,5-diamine (PubChem CID 170056186) has the molecular formula C30H44F2N4 and a molecular weight of 498.71 g/mol. Its IUPAC name is (3E)-3-[(Z)-but-2-en-2-yl]-5-N-[1-(2,2-difluoropropyl)pyrrolidin-3-yl]-2-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]hexa-1,3,5-triene-2,5-diamine.
| Compound Name | (3E)-3-[(Z)-but-2-en-2-yl]-5-N-[1-(2,2-difluoropropyl)pyrrolidin-3-yl]-2-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]hexa-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 170056186 |
| Molecular Formula | C30H44F2N4 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | (3E)-3-[(Z)-but-2-en-2-yl]-5-N-[1-(2,2-difluoropropyl)pyrrolidin-3-yl]-2-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]hexa-1,3,5-triene-2,5-diamine |
| SMILES | C=C(/C=C(C(=C)NCC(C)CN1CCc2ccccc2C1)\C(C)=C/C)NC1CCN(CC(C)(F)F)C1 |
| InChI | InChI=1S/C30H44F2N4/c1-7-23(3)29(16-24(4)34-28-13-15-36(20-28)21-30(6,31)32)25(5)33-17-22(2)18-35-14-12-26-10-8-9-11-27(26)19-35/h7-11,16,22,28,33-34H,4-5,12-15,17-21H2,1-3,6H3/b23-7-,29-16+ |
| InChIKey | MZOIDDXKKOIEEP-SLGXRRPLSA-N |
| XLogP | 5.51 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|