C19H29F3N4OS — CID 111915759
1-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915759) has the molecular formula C19H29F3N4OS and a molecular weight of 418.53 g/mol. Its IUPAC name is 1-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915759 |
| Molecular Formula | C19H29F3N4OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCC(C)CSc1ccccc1OC)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C19H29F3N4OS/c1-14(12-28-17-7-5-4-6-16(17)27-3)10-24-18(23-2)25-15-8-9-26(11-15)13-19(20,21)22/h4-7,14-15H,8-13H2,1-3H3,(H2,23,24,25) |
| InChIKey | ZEUOAQCVWRDFEE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|